C22H23NO4 — CID 9239112
methyl 3-hydroxy-4-[[(4-methoxyphenyl)methyl-methylamino]methyl]naphthalene-2-carboxylate (PubChem CID 9239112) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is methyl 3-hydroxy-4-[[(4-methoxyphenyl)methyl-methylamino]methyl]naphthalene-2-carboxylate.
| Compound Name | methyl 3-hydroxy-4-[[(4-methoxyphenyl)methyl-methylamino]methyl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 9239112 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | methyl 3-hydroxy-4-[[(4-methoxyphenyl)methyl-methylamino]methyl]naphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2c(CN(C)Cc2ccc(OC)cc2)c1O |
| InChI | InChI=1S/C22H23NO4/c1-23(13-15-8-10-17(26-2)11-9-15)14-20-18-7-5-4-6-16(18)12-19(21(20)24)22(25)27-3/h4-12,24H,13-14H2,1-3H3 |
| InChIKey | OJAGHFCXTQHMLO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|