About 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid
2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 168950769) has the molecular formula C6H4N4O2S
and a molecular weight of 196.19 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid.
Analyze 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid (CID 168950769) is 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid is O=C(O)c1ncnn1-c1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid?
The InChIKey is IUIIGIXQMHUFNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O2S/c11-5(12)4-8-3-9-10(4)6-7-1-2-13-6/h1-3H,(H,11,12).
What are the key properties of 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid?
2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid has a molecular weight of 196.19 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 168950769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).