C24H27N3 — CID 168953883
6-(2,5-dihydro-1H-pyrrol-3-yl)-N-[(1R)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 168953883) has the molecular formula C24H27N3 and a molecular weight of 357.50 g/mol. Its IUPAC name is 6-(2,5-dihydro-1H-pyrrol-3-yl)-N-[(1R)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-(2,5-dihydro-1H-pyrrol-3-yl)-N-[(1R)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 168953883 |
| Molecular Formula | C24H27N3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 6-(2,5-dihydro-1H-pyrrol-3-yl)-N-[(1R)-1-phenylethyl]-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | C[C@@H](NC1CCCc2c1[nH]c1ccc(C3=CCNC3)cc21)c1ccccc1 |
| InChI | InChI=1S/C24H27N3/c1-16(17-6-3-2-4-7-17)26-23-9-5-8-20-21-14-18(19-12-13-25-15-19)10-11-22(21)27-24(20)23/h2-4,6-7,10-12,14,16,23,25-27H,5,8-9,13,15H2,1H3/t16-,23?/m1/s1 |
| InChIKey | LLCYYESAALQTRK-ADRQNKRLSA-N |
| XLogP | 4.88 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|