C20H18N4O3 — CID 168957399
12-ethyl-10-[(4-methoxyphenyl)methyl]-11-oxo-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8-pentaene-7-carbaldehyde (PubChem CID 168957399) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 12-ethyl-10-[(4-methoxyphenyl)methyl]-11-oxo-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8-pentaene-7-carbaldehyde.
| Compound Name | 12-ethyl-10-[(4-methoxyphenyl)methyl]-11-oxo-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8-pentaene-7-carbaldehyde |
|---|---|
| PubChem CID | 168957399 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 12-ethyl-10-[(4-methoxyphenyl)methyl]-11-oxo-2,3,10,12-tetrazatricyclo[7.3.1.05,13]trideca-1(13),2,4,6,8-pentaene-7-carbaldehyde |
| SMILES | CCN1C(=O)N(Cc2ccc(OC)cc2)c2cc(C=O)cc3cnnc1c23 |
| InChI | InChI=1S/C20H18N4O3/c1-3-23-19-18-15(10-21-22-19)8-14(12-25)9-17(18)24(20(23)26)11-13-4-6-16(27-2)7-5-13/h4-10,12H,3,11H2,1-2H3 |
| InChIKey | MWPMVPRHYYOFMP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|