C19H17ClN4O2 — CID 168957475
11-chloro-4-ethyl-2-[(4-methoxyphenyl)methyl]-2,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-one (PubChem CID 168957475) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is 11-chloro-4-ethyl-2-[(4-methoxyphenyl)methyl]-2,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-one.
| Compound Name | 11-chloro-4-ethyl-2-[(4-methoxyphenyl)methyl]-2,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-one |
|---|---|
| PubChem CID | 168957475 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 11-chloro-4-ethyl-2-[(4-methoxyphenyl)methyl]-2,4,6,8-tetrazatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-3-one |
| SMILES | CCN1C(=O)N(Cc2ccc(OC)cc2)c2cc(Cl)cc3ncnc1c23 |
| InChI | InChI=1S/C19H17ClN4O2/c1-3-23-18-17-15(21-11-22-18)8-13(20)9-16(17)24(19(23)25)10-12-4-6-14(26-2)7-5-12/h4-9,11H,3,10H2,1-2H3 |
| InChIKey | PQCQQURKJNINHP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |