C33H35N5OS2 — CID 168958623
3-[4-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]butylamino]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 168958623) has the molecular formula C33H35N5OS2 and a molecular weight of 581.81 g/mol. Its IUPAC name is 3-[4-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]butylamino]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[4-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]butylamino]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 168958623 |
| Molecular Formula | C33H35N5OS2 |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | 3-[4-[[9-ethyl-7-(4-methylthiophen-2-yl)carbazol-3-yl]methylamino]butylamino]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1c2ccc(CNCCCCNc3c(C(N)=O)sc4nc(C)ccc34)cc2c2ccc(-c3cc(C)cs3)cc21 |
| InChI | InChI=1S/C33H35N5OS2/c1-4-38-27-12-8-22(16-26(27)24-11-9-23(17-28(24)38)29-15-20(2)19-40-29)18-35-13-5-6-14-36-30-25-10-7-21(3)37-33(25)41-31(30)32(34)39/h7-12,15-17,19,35-36H,4-6,13-14,18H2,1-3H3,(H2,34,39) |
| InChIKey | OGUKUHGNGPGNHJ-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|