C20H34N8O2 — CID 168960721
6-amino-2-[[2-[4-[(Z)-N'-[(Z)-1-aminoethylideneamino]carbamimidoyl]phenyl]acetyl]amino]-N-(3-aminopropyl)hexanamide (PubChem CID 168960721) has the molecular formula C20H34N8O2 and a molecular weight of 418.55 g/mol. Its IUPAC name is 6-amino-2-[[2-[4-[(Z)-N'-[(Z)-1-aminoethylideneamino]carbamimidoyl]phenyl]acetyl]amino]-N-(3-aminopropyl)hexanamide.
| Compound Name | 6-amino-2-[[2-[4-[(Z)-N'-[(Z)-1-aminoethylideneamino]carbamimidoyl]phenyl]acetyl]amino]-N-(3-aminopropyl)hexanamide |
|---|---|
| PubChem CID | 168960721 |
| Molecular Formula | C20H34N8O2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 6-amino-2-[[2-[4-[(Z)-N'-[(Z)-1-aminoethylideneamino]carbamimidoyl]phenyl]acetyl]amino]-N-(3-aminopropyl)hexanamide |
| SMILES | C/C(N)=N/N=C(\N)c1ccc(CC(=O)NC(CCCCN)C(=O)NCCCN)cc1 |
| InChI | InChI=1S/C20H34N8O2/c1-14(23)27-28-19(24)16-8-6-15(7-9-16)13-18(29)26-17(5-2-3-10-21)20(30)25-12-4-11-22/h6-9,17H,2-5,10-13,21-22H2,1H3,(H2,23,27)(H2,24,28)(H,25,30)(H,26,29) |
| InChIKey | ZRPVOWGCGCEIOL-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 187.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|