C27H32F2N4O4 — CID 168961790
3-[6-(1-benzylpiperidin-3-yl)oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2-difluoroethanamine (PubChem CID 168961790) has the molecular formula C27H32F2N4O4 and a molecular weight of 514.57 g/mol. Its IUPAC name is 3-[6-(1-benzylpiperidin-3-yl)oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2-difluoroethanamine.
| Compound Name | 3-[6-(1-benzylpiperidin-3-yl)oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2-difluoroethanamine |
|---|---|
| PubChem CID | 168961790 |
| Molecular Formula | C27H32F2N4O4 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 3-[6-(1-benzylpiperidin-3-yl)oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;2,2-difluoroethanamine |
| SMILES | NCC(F)F.O=C1CCC(N2Cc3cc(OC4CCCN(Cc5ccccc5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H27N3O4.C2H5F2N/c29-23-11-10-22(24(30)26-23)28-15-18-13-19(8-9-21(18)25(28)31)32-20-7-4-12-27(16-20)14-17-5-2-1-3-6-17;3-2(4)1-5/h1-3,5-6,8-9,13,20,22H,4,7,10-12,14-16H2,(H,26,29,30);2H,1,5H2 |
| InChIKey | IMFHLECCWDWXDI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|