C18H21ClF3N5OS — CID 168963194
4-chloro-5-(methylamino)-2-[1-[N-methyl-4-(trifluoromethyl)anilino]sulfanylpiperidin-4-yl]pyridazin-3-one (PubChem CID 168963194) has the molecular formula C18H21ClF3N5OS and a molecular weight of 447.91 g/mol. Its IUPAC name is 4-chloro-5-(methylamino)-2-[1-[N-methyl-4-(trifluoromethyl)anilino]sulfanylpiperidin-4-yl]pyridazin-3-one.
| Compound Name | 4-chloro-5-(methylamino)-2-[1-[N-methyl-4-(trifluoromethyl)anilino]sulfanylpiperidin-4-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 168963194 |
| Molecular Formula | C18H21ClF3N5OS |
| Molecular Weight | 447.91 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 4-chloro-5-(methylamino)-2-[1-[N-methyl-4-(trifluoromethyl)anilino]sulfanylpiperidin-4-yl]pyridazin-3-one |
| SMILES | CNc1cnn(C2CCN(SN(C)c3ccc(C(F)(F)F)cc3)CC2)c(=O)c1Cl |
| InChI | InChI=1S/C18H21ClF3N5OS/c1-23-15-11-24-27(17(28)16(15)19)14-7-9-26(10-8-14)29-25(2)13-5-3-12(4-6-13)18(20,21)22/h3-6,11,14,23H,7-10H2,1-2H3 |
| InChIKey | LZUPGWGMSGUTJC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|