C17H14Cl2F3N5OS — CID 171823807
4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)piperidin-1-yl]sulfanyl-(difluoromethyl)amino]-3-fluorobenzonitrile (PubChem CID 171823807) has the molecular formula C17H14Cl2F3N5OS and a molecular weight of 464.30 g/mol. Its IUPAC name is 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)piperidin-1-yl]sulfanyl-(difluoromethyl)amino]-3-fluorobenzonitrile.
| Compound Name | 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)piperidin-1-yl]sulfanyl-(difluoromethyl)amino]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 171823807 |
| Molecular Formula | C17H14Cl2F3N5OS |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 4-[[4-(4,5-dichloro-6-oxopyridazin-1-yl)piperidin-1-yl]sulfanyl-(difluoromethyl)amino]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(N(SN2CCC(n3ncc(Cl)c(Cl)c3=O)CC2)C(F)F)c(F)c1 |
| InChI | InChI=1S/C17H14Cl2F3N5OS/c18-12-9-24-26(16(28)15(12)19)11-3-5-25(6-4-11)29-27(17(21)22)14-2-1-10(8-23)7-13(14)20/h1-2,7,9,11,17H,3-6H2 |
| InChIKey | OVKPWWZZMRTOLZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|