C16H20ClN5OS — CID 168963468
5-amino-4-chloro-2-[1-(N-methylanilino)sulfanylpiperidin-4-yl]pyridazin-3-one (PubChem CID 168963468) has the molecular formula C16H20ClN5OS and a molecular weight of 365.89 g/mol. Its IUPAC name is 5-amino-4-chloro-2-[1-(N-methylanilino)sulfanylpiperidin-4-yl]pyridazin-3-one.
| Compound Name | 5-amino-4-chloro-2-[1-(N-methylanilino)sulfanylpiperidin-4-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 168963468 |
| Molecular Formula | C16H20ClN5OS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 5-amino-4-chloro-2-[1-(N-methylanilino)sulfanylpiperidin-4-yl]pyridazin-3-one |
| SMILES | CN(SN1CCC(n2ncc(N)c(Cl)c2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H20ClN5OS/c1-20(12-5-3-2-4-6-12)24-21-9-7-13(8-10-21)22-16(23)15(17)14(18)11-19-22/h2-6,11,13H,7-10,18H2,1H3 |
| InChIKey | JKOVQOCZJGZZFP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|