C15H27F2N3O4 — CID 168964411
tert-butyl 3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]piperidine-1-carboxylate (PubChem CID 168964411) has the molecular formula C15H27F2N3O4 and a molecular weight of 351.39 g/mol. Its IUPAC name is tert-butyl 3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 168964411 |
| Molecular Formula | C15H27F2N3O4 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl 3,5-difluoro-4-[2-[(2-methylpropan-2-yl)oxycarbonyl]hydrazinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)NNC1C(F)CN(C(=O)OC(C)(C)C)CC1F |
| InChI | InChI=1S/C15H27F2N3O4/c1-14(2,3)23-12(21)19-18-11-9(16)7-20(8-10(11)17)13(22)24-15(4,5)6/h9-11,18H,7-8H2,1-6H3,(H,19,21) |
| InChIKey | SSFPRINNMPJLPD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|