C20H20F4N3O2P — CID 168968732
4-[3-[fluoro(phosphanyl)methyl]phenyl]-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)piperidine-3-carbohydrazide (PubChem CID 168968732) has the molecular formula C20H20F4N3O2P and a molecular weight of 441.37 g/mol. Its IUPAC name is 4-[3-[fluoro(phosphanyl)methyl]phenyl]-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)piperidine-3-carbohydrazide.
| Compound Name | 4-[3-[fluoro(phosphanyl)methyl]phenyl]-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)piperidine-3-carbohydrazide |
|---|---|
| PubChem CID | 168968732 |
| Molecular Formula | C20H20F4N3O2P |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 4-[3-[fluoro(phosphanyl)methyl]phenyl]-1-methyl-2-oxo-N-(2,3,4-trifluorophenyl)piperidine-3-carbohydrazide |
| SMILES | CN1CCC(c2cccc(C(F)P)c2)C(C(=O)N(N)c2ccc(F)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H20F4N3O2P/c1-26-8-7-12(10-3-2-4-11(9-10)18(24)30)15(19(26)28)20(29)27(25)14-6-5-13(21)16(22)17(14)23/h2-6,9,12,15,18H,7-8,25,30H2,1H3 |
| InChIKey | OUTGFFZSUPGGEC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|