C18H13F5N3O2W- — CID 168968738
N-(2,3-difluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-ide-3-carbohydrazide;tungsten (PubChem CID 168968738) has the molecular formula C18H13F5N3O2W- and a molecular weight of 582.15 g/mol. Its IUPAC name is N-(2,3-difluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-ide-3-carbohydrazide;tungsten.
| Compound Name | N-(2,3-difluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-ide-3-carbohydrazide;tungsten |
|---|---|
| PubChem CID | 168968738 |
| Molecular Formula | C18H13F5N3O2W- |
| Molecular Weight | 582.15 g/mol |
| Exact Mass | 582.04 |
| IUPAC Name | N-(2,3-difluorophenyl)-2-oxo-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-ide-3-carbohydrazide;tungsten |
| SMILES | NN(C(=O)C1C(=O)[N-]CC1c1cccc(C(F)(F)F)c1)c1cccc(F)c1F.[W] |
| InChI | InChI=1S/C18H14F5N3O2.W/c19-12-5-2-6-13(15(12)20)26(24)17(28)14-11(8-25-16(14)27)9-3-1-4-10(7-9)18(21,22)23;/h1-7,11,14H,8,24H2,(H,25,27);/p-1 |
| InChIKey | NASQBHGORMLKBV-UHFFFAOYSA-M |
| XLogP | 3.50 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.15 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|