C36H44N2O8SSi — CID 168969704
2-[4-[(3-methoxy-2-methylphenyl)methyl-[4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]-1,5-dimethylpyrrol-2-yl]-4-methylsulfonylbenzoic acid (PubChem CID 168969704) has the molecular formula C36H44N2O8SSi and a molecular weight of 692.91 g/mol. Its IUPAC name is 2-[4-[(3-methoxy-2-methylphenyl)methyl-[4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]-1,5-dimethylpyrrol-2-yl]-4-methylsulfonylbenzoic acid.
| Compound Name | 2-[4-[(3-methoxy-2-methylphenyl)methyl-[4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]-1,5-dimethylpyrrol-2-yl]-4-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 168969704 |
| Molecular Formula | C36H44N2O8SSi |
| Molecular Weight | 692.91 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 2-[4-[(3-methoxy-2-methylphenyl)methyl-[4-(2-trimethylsilylethoxymethoxy)phenyl]carbamoyl]-1,5-dimethylpyrrol-2-yl]-4-methylsulfonylbenzoic acid |
| SMILES | COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)O)n(C)c2C)c2ccc(OCOCC[Si](C)(C)C)cc2)c1C |
| InChI | InChI=1S/C36H44N2O8SSi/c1-24-26(10-9-11-34(24)44-4)22-38(27-12-14-28(15-13-27)46-23-45-18-19-48(6,7)8)35(39)31-21-33(37(3)25(31)2)32-20-29(47(5,42)43)16-17-30(32)36(40)41/h9-17,20-21H,18-19,22-23H2,1-8H3,(H,40,41) |
| InChIKey | IOFSIDUJEFAAAB-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.91 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|