C30H29N2O7SSe — CID 168969545
CID 168969545 (PubChem CID 168969545) has the molecular formula C30H29N2O7SSe and a molecular weight of 640.60 g/mol.
| Compound Name | CID 168969545 |
|---|---|
| PubChem CID | 168969545 |
| Molecular Formula | C30H29N2O7SSe |
| Molecular Weight | 640.60 g/mol |
| Exact Mass | 641.09 |
| IUPAC Name | — |
| SMILES | COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)O)n(C)c2C)c2ccc(O[Se])cc2)c1C |
| InChI | InChI=1S/C30H29N2O7SSe/c1-18-20(7-6-8-28(18)38-4)17-32(21-9-11-22(39-41)12-10-21)29(33)25-16-27(31(3)19(25)2)26-15-23(40(5,36)37)13-14-24(26)30(34)35/h6-16H,17H2,1-5H3,(H,34,35) |
| InChIKey | IEHMCTMZTNFNAO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|