C34H41N2O7SSe — CID 168969544
CID 168969544 (PubChem CID 168969544) has the molecular formula C34H41N2O7SSe and a molecular weight of 700.74 g/mol.
| Compound Name | CID 168969544 |
|---|---|
| PubChem CID | 168969544 |
| Molecular Formula | C34H41N2O7SSe |
| Molecular Weight | 700.74 g/mol |
| Exact Mass | 701.18 |
| IUPAC Name | — |
| SMILES | CC.CC.COc1cccc(CN(C(=O)c2cc(-c3cc(S(C)(=O)=O)ccc3C(=O)O)n(C)c2C)c2ccc(O[Se])cc2)c1C |
| InChI | InChI=1S/C30H29N2O7SSe.2C2H6/c1-18-20(7-6-8-28(18)38-4)17-32(21-9-11-22(39-41)12-10-21)29(33)25-16-27(31(3)19(25)2)26-15-23(40(5,36)37)13-14-24(26)30(34)35;2*1-2/h6-16H,17H2,1-5H3,(H,34,35);2*1-2H3 |
| InChIKey | IWSFENHCCYQCPU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|