C11H13N3 — CID 168972677
(Z)-4-methylidene-2-(pentan-2-ylideneamino)pent-2-enedinitrile (PubChem CID 168972677) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (Z)-4-methylidene-2-(pentan-2-ylideneamino)pent-2-enedinitrile.
| Compound Name | (Z)-4-methylidene-2-(pentan-2-ylideneamino)pent-2-enedinitrile |
|---|---|
| PubChem CID | 168972677 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (Z)-4-methylidene-2-(pentan-2-ylideneamino)pent-2-enedinitrile |
| SMILES | C=C(C#N)/C=C(C#N)\N=C(/C)CCC |
| InChI | InChI=1S/C11H13N3/c1-4-5-10(3)14-11(8-13)6-9(2)7-12/h6H,2,4-5H2,1,3H3/b11-6-,14-10+ |
| InChIKey | VNDRJLBJJKSJDU-HNPFEXMKSA-N |
| XLogP | 2.73 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|