C12H22N2O8S — CID 168976058
methanol;5-[[1-[(2-methylperoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 168976058) has the molecular formula C12H22N2O8S and a molecular weight of 354.38 g/mol. Its IUPAC name is methanol;5-[[1-[(2-methylperoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | methanol;5-[[1-[(2-methylperoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168976058 |
| Molecular Formula | C12H22N2O8S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methanol;5-[[1-[(2-methylperoxy-2-oxoethyl)amino]-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CO.COOC(=O)CNC(=O)C(CS)NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C11H18N2O7S.CH4O/c1-19-20-10(17)5-12-11(18)7(6-21)13-8(14)3-2-4-9(15)16;1-2/h7,21H,2-6H2,1H3,(H,12,18)(H,13,14)(H,15,16);2H,1H3 |
| InChIKey | CCMOKEUNHRWIKF-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|