C16H29N3O — CID 168983397
1-(cyclopropylmethyl)-4,10,10-trimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde (PubChem CID 168983397) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4,10,10-trimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde.
| Compound Name | 1-(cyclopropylmethyl)-4,10,10-trimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
|---|---|
| PubChem CID | 168983397 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 1-(cyclopropylmethyl)-4,10,10-trimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde |
| SMILES | CN1CCN(CC2CC2)C2(CCN(C=O)C(C)(C)C2)C1 |
| InChI | InChI=1S/C16H29N3O/c1-15(2)11-16(6-7-19(15)13-20)12-17(3)8-9-18(16)10-14-4-5-14/h13-14H,4-12H2,1-3H3 |
| InChIKey | PRLOQVXBQAYUQF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|