C18H42N4O — CID 166115065
N,N-dimethylmethanamine;1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde;ethane (PubChem CID 166115065) has the molecular formula C18H42N4O and a molecular weight of 330.56 g/mol. Its IUPAC name is N,N-dimethylmethanamine;1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde;ethane.
| Compound Name | N,N-dimethylmethanamine;1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde;ethane |
|---|---|
| PubChem CID | 166115065 |
| Molecular Formula | C18H42N4O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.34 |
| IUPAC Name | N,N-dimethylmethanamine;1,4-dimethyl-1,4,9-triazaspiro[5.5]undecane-9-carbaldehyde;ethane |
| SMILES | CC.CC.CN(C)C.CN1CCN(C)C2(CCN(C=O)CC2)C1 |
| InChI | InChI=1S/C11H21N3O.C3H9N.2C2H6/c1-12-7-8-13(2)11(9-12)3-5-14(10-15)6-4-11;1-4(2)3;2*1-2/h10H,3-9H2,1-2H3;1-3H3;2*1-2H3 |
| InChIKey | PUYRLLVKXQNICM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|