C38H57NO3 — CID 168997879
1-[1-(4-butoxyphenyl)cyclobutyl]ethanone;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile;propane (PubChem CID 168997879) has the molecular formula C38H57NO3 and a molecular weight of 575.88 g/mol. Its IUPAC name is 1-[1-(4-butoxyphenyl)cyclobutyl]ethanone;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile;propane.
| Compound Name | 1-[1-(4-butoxyphenyl)cyclobutyl]ethanone;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile;propane |
|---|---|
| PubChem CID | 168997879 |
| Molecular Formula | C38H57NO3 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 575.43 |
| IUPAC Name | 1-[1-(4-butoxyphenyl)cyclobutyl]ethanone;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile;propane |
| SMILES | CCC.CCCC(=O)C(CCC)(CCC)c1cc(C#N)ccc1C.CCCCOc1ccc(C2(C(C)=O)CCC2)cc1 |
| InChI | InChI=1S/C19H27NO.C16H22O2.C3H8/c1-5-8-18(21)19(11-6-2,12-7-3)17-13-16(14-20)10-9-15(17)4;1-3-4-12-18-15-8-6-14(7-9-15)16(13(2)17)10-5-11-16;1-3-2/h9-10,13H,5-8,11-12H2,1-4H3;6-9H,3-5,10-12H2,1-2H3;3H2,1-2H3 |
| InChIKey | CLCBSAPDQYOAPG-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|