C33H48N2O3 — CID 168998342
2-(4-butoxyphenyl)-2-methylpropanamide;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile (PubChem CID 168998342) has the molecular formula C33H48N2O3 and a molecular weight of 520.76 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-2-methylpropanamide;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile.
| Compound Name | 2-(4-butoxyphenyl)-2-methylpropanamide;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile |
|---|---|
| PubChem CID | 168998342 |
| Molecular Formula | C33H48N2O3 |
| Molecular Weight | 520.76 g/mol |
| Exact Mass | 520.37 |
| IUPAC Name | 2-(4-butoxyphenyl)-2-methylpropanamide;4-methyl-3-(5-oxo-4-propyloctan-4-yl)benzonitrile |
| SMILES | CCCC(=O)C(CCC)(CCC)c1cc(C#N)ccc1C.CCCCOc1ccc(C(C)(C)C(N)=O)cc1 |
| InChI | InChI=1S/C19H27NO.C14H21NO2/c1-5-8-18(21)19(11-6-2,12-7-3)17-13-16(14-20)10-9-15(17)4;1-4-5-10-17-12-8-6-11(7-9-12)14(2,3)13(15)16/h9-10,13H,5-8,11-12H2,1-4H3;6-9H,4-5,10H2,1-3H3,(H2,15,16) |
| InChIKey | DOQIUVOWWRNYOW-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.76 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|