C24H19F5N4O3 — CID 169006812
6-[[3,5-difluoro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one (PubChem CID 169006812) has the molecular formula C24H19F5N4O3 and a molecular weight of 506.43 g/mol. Its IUPAC name is 6-[[3,5-difluoro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one.
| Compound Name | 6-[[3,5-difluoro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one |
|---|---|
| PubChem CID | 169006812 |
| Molecular Formula | C24H19F5N4O3 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 6-[[3,5-difluoro-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]methoxy]-3,5,9-triazatetracyclo[8.2.2.01,9.03,8]tetradeca-5,7-dien-4-one |
| SMILES | O=c1nc(OCc2cc(F)c(Oc3cccc(C(F)(F)F)n3)c(F)c2)cc2n1CC13CCC(CC1)N23 |
| InChI | InChI=1S/C24H19F5N4O3/c25-15-8-13(9-16(26)21(15)36-18-3-1-2-17(30-18)24(27,28)29)11-35-19-10-20-32(22(34)31-19)12-23-6-4-14(5-7-23)33(20)23/h1-3,8-10,14H,4-7,11-12H2 |
| InChIKey | IZLUWIMFIUIXLU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |