C12H8F7NO2 — CID 169008861
4-[1,3-dihydroxy-2-(trifluoromethyl)butyl]-2,3,5,6-tetrafluorobenzonitrile (PubChem CID 169008861) has the molecular formula C12H8F7NO2 and a molecular weight of 331.19 g/mol. Its IUPAC name is 4-[1,3-dihydroxy-2-(trifluoromethyl)butyl]-2,3,5,6-tetrafluorobenzonitrile.
| Compound Name | 4-[1,3-dihydroxy-2-(trifluoromethyl)butyl]-2,3,5,6-tetrafluorobenzonitrile |
|---|---|
| PubChem CID | 169008861 |
| Molecular Formula | C12H8F7NO2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[1,3-dihydroxy-2-(trifluoromethyl)butyl]-2,3,5,6-tetrafluorobenzonitrile |
| SMILES | CC(O)C(C(O)c1c(F)c(F)c(C#N)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C12H8F7NO2/c1-3(21)6(12(17,18)19)11(22)5-9(15)7(13)4(2-20)8(14)10(5)16/h3,6,11,21-22H,1H3 |
| InChIKey | HPOPFPBGARCPJK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|