C37H46N6O5Si — CID 169013570
9H-fluoren-9-ylmethyl N-[(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamate (PubChem CID 169013570) has the molecular formula C37H46N6O5Si and a molecular weight of 682.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 169013570 |
| Molecular Formula | C37H46N6O5Si |
| Molecular Weight | 682.90 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nccn1-c1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)OCC2c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C37H46N6O5Si/c1-37(2,3)49(4,5)48-24-33-39-21-22-43(33)26-18-16-25(17-19-26)41-34(44)32(15-10-20-40-35(38)45)42-36(46)47-23-31-29-13-8-6-11-27(29)28-12-7-9-14-30(28)31/h6-9,11-14,16-19,21-22,31-32H,10,15,20,23-24H2,1-5H3,(H,41,44)(H,42,46)(H3,38,40,45)/t32-/m0/s1 |
| InChIKey | ALXJDAGQAACNAA-YTTGMZPUSA-N |
| XLogP | 6.69 |
| TPSA | 149.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.90 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|