C23H36N6O5Si — CID 174056567
[(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamic acid (PubChem CID 174056567) has the molecular formula C23H36N6O5Si and a molecular weight of 504.66 g/mol. Its IUPAC name is [(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174056567 |
| Molecular Formula | C23H36N6O5Si |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [(2S)-1-[4-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]imidazol-1-yl]anilino]-5-(carbamoylamino)-1-oxopentan-2-yl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCc1nccn1-c1ccc(NC(=O)[C@H](CCCNC(N)=O)NC(=O)O)cc1 |
| InChI | InChI=1S/C23H36N6O5Si/c1-23(2,3)35(4,5)34-15-19-25-13-14-29(19)17-10-8-16(9-11-17)27-20(30)18(28-22(32)33)7-6-12-26-21(24)31/h8-11,13-14,18,28H,6-7,12,15H2,1-5H3,(H,27,30)(H,32,33)(H3,24,26,31)/t18-/m0/s1 |
| InChIKey | VROGWDCVLXJSKM-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|