C19H18N8OS — CID 169013733
6-(1,3-benzothiazol-2-yldiazenyl)-3-(dimethylamino)-2-[(2-methylpyrazol-3-yl)diazenyl]phenol (PubChem CID 169013733) has the molecular formula C19H18N8OS and a molecular weight of 406.48 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-yldiazenyl)-3-(dimethylamino)-2-[(2-methylpyrazol-3-yl)diazenyl]phenol.
| Compound Name | 6-(1,3-benzothiazol-2-yldiazenyl)-3-(dimethylamino)-2-[(2-methylpyrazol-3-yl)diazenyl]phenol |
|---|---|
| PubChem CID | 169013733 |
| Molecular Formula | C19H18N8OS |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-(1,3-benzothiazol-2-yldiazenyl)-3-(dimethylamino)-2-[(2-methylpyrazol-3-yl)diazenyl]phenol |
| SMILES | CN(C)c1ccc(/N=N/c2nc3ccccc3s2)c(O)c1/N=N/c1ccnn1C |
| InChI | InChI=1S/C19H18N8OS/c1-26(2)14-9-8-13(18(28)17(14)24-23-16-10-11-20-27(16)3)22-25-19-21-12-6-4-5-7-15(12)29-19/h4-11,28H,1-3H3/b24-23+,25-22+ |
| InChIKey | FZNQSTKJNHVKNE-YXCVZRPCSA-N |
| XLogP | 5.63 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|