C22H27ClN4O6 — CID 169021515
ethyl 5-[(Z)-[6-chloro-5-[2-[2-(methylamino)ethoxy]ethoxy]-2-oxo-1H-indol-3-ylidene]methyl]-1-(methoxymethyl)pyrazole-4-carboxylate (PubChem CID 169021515) has the molecular formula C22H27ClN4O6 and a molecular weight of 478.93 g/mol. Its IUPAC name is ethyl 5-[(Z)-[6-chloro-5-[2-[2-(methylamino)ethoxy]ethoxy]-2-oxo-1H-indol-3-ylidene]methyl]-1-(methoxymethyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(Z)-[6-chloro-5-[2-[2-(methylamino)ethoxy]ethoxy]-2-oxo-1H-indol-3-ylidene]methyl]-1-(methoxymethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 169021515 |
| Molecular Formula | C22H27ClN4O6 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | ethyl 5-[(Z)-[6-chloro-5-[2-[2-(methylamino)ethoxy]ethoxy]-2-oxo-1H-indol-3-ylidene]methyl]-1-(methoxymethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(COC)c1/C=C1\C(=O)Nc2cc(Cl)c(OCCOCCNC)cc21 |
| InChI | InChI=1S/C22H27ClN4O6/c1-4-32-22(29)16-12-25-27(13-30-3)19(16)9-15-14-10-20(33-8-7-31-6-5-24-2)17(23)11-18(14)26-21(15)28/h9-12,24H,4-8,13H2,1-3H3,(H,26,28)/b15-9- |
| InChIKey | GEFWTQHSNBTMNA-DHDCSXOGSA-N |
| XLogP | 2.42 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|