C25H6F9N3 — CID 169021885
2,4,6-tris(2,4,6-trifluorophenyl)pyridine-3,5-dicarbonitrile (PubChem CID 169021885) has the molecular formula C25H6F9N3 and a molecular weight of 519.33 g/mol. Its IUPAC name is 2,4,6-tris(2,4,6-trifluorophenyl)pyridine-3,5-dicarbonitrile.
| Compound Name | 2,4,6-tris(2,4,6-trifluorophenyl)pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 169021885 |
| Molecular Formula | C25H6F9N3 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 2,4,6-tris(2,4,6-trifluorophenyl)pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(-c2c(F)cc(F)cc2F)nc(-c2c(F)cc(F)cc2F)c(C#N)c1-c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C25H6F9N3/c26-9-1-14(29)21(15(30)2-9)20-12(7-35)24(22-16(31)3-10(27)4-17(22)32)37-25(13(20)8-36)23-18(33)5-11(28)6-19(23)34/h1-6H |
| InChIKey | KWWXYVKFVDLRPZ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |