C22H30O3 — CID 169025521
(E)-1-[(2R,4R,4aR)-2,4-dihydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-phenylbut-3-en-2-one (PubChem CID 169025521) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is (E)-1-[(2R,4R,4aR)-2,4-dihydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-phenylbut-3-en-2-one.
| Compound Name | (E)-1-[(2R,4R,4aR)-2,4-dihydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-phenylbut-3-en-2-one |
|---|---|
| PubChem CID | 169025521 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (E)-1-[(2R,4R,4aR)-2,4-dihydroxy-1,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydronaphthalen-1-yl]-4-phenylbut-3-en-2-one |
| SMILES | CC1(CC(=O)/C=C/c2ccccc2)C2CCCC[C@@]2(C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H30O3/c1-21-13-7-6-10-18(21)22(2,20(25)14-19(21)24)15-17(23)12-11-16-8-4-3-5-9-16/h3-5,8-9,11-12,18-20,24-25H,6-7,10,13-15H2,1-2H3/b12-11+/t18?,19-,20-,21-,22?/m1/s1 |
| InChIKey | WPKJDGCBVQLIEQ-WVFXCRFXSA-N |
| XLogP | 3.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|