C39H35N3O6 — CID 169032236
3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (PubChem CID 169032236) has the molecular formula C39H35N3O6 and a molecular weight of 641.72 g/mol. Its IUPAC name is 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 169032236 |
| Molecular Formula | C39H35N3O6 |
| Molecular Weight | 641.72 g/mol |
| Exact Mass | 641.25 |
| IUPAC Name | 3-[[6-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-6-oxohexanoyl]amino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| SMILES | O=C(CCCCC(=O)N1Cc2ccccc2C#Cc2ccccc21)NCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C39H35N3O6/c43-36(19-9-10-20-37(44)42-24-28-13-2-1-11-26(28)21-22-27-12-3-8-18-35(27)42)40-23-34(38(45)46)41-39(47)48-25-33-31-16-6-4-14-29(31)30-15-5-7-17-32(30)33/h1-8,11-18,33-34H,9-10,19-20,23-25H2,(H,40,43)(H,41,47)(H,45,46) |
| InChIKey | LGLVOWLKRROGET-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|