C23H46N4O5 — CID 169035406
tert-butyl N-[2-[8-(tert-butylcarbamoylamino)octoxycarbonyl-methylamino]ethyl]-N-methylcarbamate (PubChem CID 169035406) has the molecular formula C23H46N4O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is tert-butyl N-[2-[8-(tert-butylcarbamoylamino)octoxycarbonyl-methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[8-(tert-butylcarbamoylamino)octoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 169035406 |
| Molecular Formula | C23H46N4O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.35 |
| IUPAC Name | tert-butyl N-[2-[8-(tert-butylcarbamoylamino)octoxycarbonyl-methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCN(C)C(=O)OC(C)(C)C)C(=O)OCCCCCCCCNC(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H46N4O5/c1-22(2,3)25-19(28)24-15-13-11-9-10-12-14-18-31-20(29)26(7)16-17-27(8)21(30)32-23(4,5)6/h9-18H2,1-8H3,(H2,24,25,28) |
| InChIKey | VQBOXAKOIURUNV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|