C26H20N4O2 — CID 169036367
6,16-dipropyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione (PubChem CID 169036367) has the molecular formula C26H20N4O2 and a molecular weight of 420.47 g/mol. Its IUPAC name is 6,16-dipropyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione.
| Compound Name | 6,16-dipropyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione |
|---|---|
| PubChem CID | 169036367 |
| Molecular Formula | C26H20N4O2 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 6,16-dipropyl-6,10,16,20-tetrazaheptacyclo[13.5.2.22,5.03,11.04,8.012,21.018,22]tetracosa-1(20),2,4,8,10,12(21),13,15(22),18,23-decaene-7,17-dione |
| SMILES | CCCN1C(=O)c2cnc3c4ccc5c6c(cnc(c7ccc1c2c73)c64)C(=O)N5CCC |
| InChI | InChI=1S/C26H20N4O2/c1-3-9-29-17-7-5-13-21-19(17)15(25(29)31)11-27-23(21)14-6-8-18-20-16(12-28-24(13)22(14)20)26(32)30(18)10-4-2/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | UPCBNHNRRZNIMG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|