C6H12N2O2 — CID 169042103
(1R,3R)-7-amino-7-azabicyclo[2.2.1]heptane-2,3-diol (PubChem CID 169042103) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is (1R,3R)-7-amino-7-azabicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (1R,3R)-7-amino-7-azabicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 169042103 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (1R,3R)-7-amino-7-azabicyclo[2.2.1]heptane-2,3-diol |
| SMILES | NN1C2CC[C@@H]1C(O)[C@@H]2O |
| InChI | InChI=1S/C6H12N2O2/c7-8-3-1-2-4(8)6(10)5(3)9/h3-6,9-10H,1-2,7H2/t3-,4?,5?,6-/m1/s1 |
| InChIKey | USUGFZACUQIOAP-YLZRJQLMSA-N |
| XLogP | -1.57 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|