C16H30N2O8 — CID 169087231
[(2R,3R,4S,5R)-6-(butanoylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] (2S)-2-amino-4-methylpentanoate (PubChem CID 169087231) has the molecular formula C16H30N2O8 and a molecular weight of 378.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-6-(butanoylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] (2S)-2-amino-4-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R)-6-(butanoylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] (2S)-2-amino-4-methylpentanoate |
|---|---|
| PubChem CID | 169087231 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(2R,3R,4S,5R)-6-(butanoylamino)-2,3,4,5-tetrahydroxy-6-oxohexyl] (2S)-2-amino-4-methylpentanoate |
| SMILES | CCCC(=O)NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C16H30N2O8/c1-4-5-11(20)18-15(24)14(23)13(22)12(21)10(19)7-26-16(25)9(17)6-8(2)3/h8-10,12-14,19,21-23H,4-7,17H2,1-3H3,(H,18,20,24)/t9-,10+,12+,13-,14+/m0/s1 |
| InChIKey | FKPIKYSRUHDDJC-QLPDKGEUSA-N |
| XLogP | -2.21 |
| TPSA | 179.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |