C16H34O2 — CID 169087826
3-tert-butyl-2-tert-butylperoxy-2,4,4-trimethylpentane (PubChem CID 169087826) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 3-tert-butyl-2-tert-butylperoxy-2,4,4-trimethylpentane.
| Compound Name | 3-tert-butyl-2-tert-butylperoxy-2,4,4-trimethylpentane |
|---|---|
| PubChem CID | 169087826 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 3-tert-butyl-2-tert-butylperoxy-2,4,4-trimethylpentane |
| SMILES | CC(C)(C)OOC(C)(C)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2/c1-13(2,3)12(14(4,5)6)16(10,11)18-17-15(7,8)9/h12H,1-11H3 |
| InChIKey | SSMLQKDXRKIXFM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|