C24H46O4 — CID 161293779
6-tert-butyl-2,5-bis(tert-butylperoxy)-2,5,7,7-tetramethyloct-3-yne (PubChem CID 161293779) has the molecular formula C24H46O4 and a molecular weight of 398.63 g/mol. Its IUPAC name is 6-tert-butyl-2,5-bis(tert-butylperoxy)-2,5,7,7-tetramethyloct-3-yne.
| Compound Name | 6-tert-butyl-2,5-bis(tert-butylperoxy)-2,5,7,7-tetramethyloct-3-yne |
|---|---|
| PubChem CID | 161293779 |
| Molecular Formula | C24H46O4 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 6-tert-butyl-2,5-bis(tert-butylperoxy)-2,5,7,7-tetramethyloct-3-yne |
| SMILES | CC(C)(C)OOC(C)(C)C#CC(C)(OOC(C)(C)C)C(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H46O4/c1-19(2,3)18(20(4,5)6)24(15,28-26-22(10,11)12)17-16-23(13,14)27-25-21(7,8)9/h18H,1-15H3 |
| InChIKey | VGRYDMKDULFILI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|