C32H62O8 — CID 87450014
2,5,9-tris(tert-butylperoxy)-7-(2-tert-butylperoxypropan-2-yl)-2,5,9-trimethyldec-3-yne (PubChem CID 87450014) has the molecular formula C32H62O8 and a molecular weight of 574.84 g/mol. Its IUPAC name is 2,5,9-tris(tert-butylperoxy)-7-(2-tert-butylperoxypropan-2-yl)-2,5,9-trimethyldec-3-yne.
| Compound Name | 2,5,9-tris(tert-butylperoxy)-7-(2-tert-butylperoxypropan-2-yl)-2,5,9-trimethyldec-3-yne |
|---|---|
| PubChem CID | 87450014 |
| Molecular Formula | C32H62O8 |
| Molecular Weight | 574.84 g/mol |
| Exact Mass | 574.44 |
| IUPAC Name | 2,5,9-tris(tert-butylperoxy)-7-(2-tert-butylperoxypropan-2-yl)-2,5,9-trimethyldec-3-yne |
| SMILES | CC(C)(C)OOC(C)(C)C#CC(C)(CC(CC(C)(C)OOC(C)(C)C)C(C)(C)OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C32H62O8/c1-25(2,3)33-37-29(13,14)20-21-32(19,40-36-28(10,11)12)23-24(31(17,18)39-35-27(7,8)9)22-30(15,16)38-34-26(4,5)6/h24H,22-23H2,1-19H3 |
| InChIKey | VYRWXZFXUTZWOL-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.84 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|