C12H13N3O — CID 169088323
2-(oxolan-3-yl)-1,5-naphthyridin-3-amine (PubChem CID 169088323) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-(oxolan-3-yl)-1,5-naphthyridin-3-amine.
| Compound Name | 2-(oxolan-3-yl)-1,5-naphthyridin-3-amine |
|---|---|
| PubChem CID | 169088323 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(oxolan-3-yl)-1,5-naphthyridin-3-amine |
| SMILES | Nc1cc2ncccc2nc1C1CCOC1 |
| InChI | InChI=1S/C12H13N3O/c13-9-6-11-10(2-1-4-14-11)15-12(9)8-3-5-16-7-8/h1-2,4,6,8H,3,5,7,13H2 |
| InChIKey | RGZIEVXCXNIPPT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |