C9H6F2INO2 — CID 169092784
4,4-difluoro-3-hydroxy-6-iodo-2,3-dihydroisoquinolin-1-one (PubChem CID 169092784) has the molecular formula C9H6F2INO2 and a molecular weight of 325.05 g/mol. Its IUPAC name is 4,4-difluoro-3-hydroxy-6-iodo-2,3-dihydroisoquinolin-1-one.
| Compound Name | 4,4-difluoro-3-hydroxy-6-iodo-2,3-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 169092784 |
| Molecular Formula | C9H6F2INO2 |
| Molecular Weight | 325.05 g/mol |
| Exact Mass | 324.94 |
| IUPAC Name | 4,4-difluoro-3-hydroxy-6-iodo-2,3-dihydroisoquinolin-1-one |
| SMILES | O=C1NC(O)C(F)(F)c2cc(I)ccc21 |
| InChI | InChI=1S/C9H6F2INO2/c10-9(11)6-3-4(12)1-2-5(6)7(14)13-8(9)15/h1-3,8,15H,(H,13,14) |
| InChIKey | ANGDCXNXIDXWHA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.05 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|