C15H18BrN5O8 — CID 169094341
[[(2R,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-bromo-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] propanoate (PubChem CID 169094341) has the molecular formula C15H18BrN5O8 and a molecular weight of 476.24 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-bromo-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] propanoate.
| Compound Name | [[(2R,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-bromo-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] propanoate |
|---|---|
| PubChem CID | 169094341 |
| Molecular Formula | C15H18BrN5O8 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | [[(2R,3S,4R,5R)-4-acetyloxy-5-(6-aminopurin-9-yl)-3-bromo-3,4-dihydroxyoxolan-2-yl]-hydroxymethyl] propanoate |
| SMILES | CCC(=O)OC(O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@](O)(OC(C)=O)[C@@]1(O)Br |
| InChI | InChI=1S/C15H18BrN5O8/c1-3-7(23)27-12(24)9-14(16,25)15(26,29-6(2)22)13(28-9)21-5-20-8-10(17)18-4-19-11(8)21/h4-5,9,12-13,24-26H,3H2,1-2H3,(H2,17,18,19)/t9-,12?,13-,14-,15-/m1/s1 |
| InChIKey | INVWHHVKTYQYTM-HQAZAOTFSA-N |
| XLogP | -1.09 |
| TPSA | 192.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|