C15H17BrN2S — CID 169112695
5-bromo-2-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-1,3-benzothiazole (PubChem CID 169112695) has the molecular formula C15H17BrN2S and a molecular weight of 337.29 g/mol. Its IUPAC name is 5-bromo-2-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-1,3-benzothiazole.
| Compound Name | 5-bromo-2-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169112695 |
| Molecular Formula | C15H17BrN2S |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 5-bromo-2-(2-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl)-1,3-benzothiazole |
| SMILES | CN1CC2CC(c3nc4cc(Br)ccc4s3)CC2C1 |
| InChI | InChI=1S/C15H17BrN2S/c1-18-7-10-4-9(5-11(10)8-18)15-17-13-6-12(16)2-3-14(13)19-15/h2-3,6,9-11H,4-5,7-8H2,1H3 |
| InChIKey | IPJJBMJJUSYNCO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |