C13H15BrN2S — CID 55148266
3-(5-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine (PubChem CID 55148266) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 3-(5-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine.
| Compound Name | 3-(5-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 55148266 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-(5-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
| SMILES | NC1CCCC(c2nc3cc(Br)ccc3s2)C1 |
| InChI | InChI=1S/C13H15BrN2S/c14-9-4-5-12-11(7-9)16-13(17-12)8-2-1-3-10(15)6-8/h4-5,7-8,10H,1-3,6,15H2 |
| InChIKey | IIRWBXQDDIASSF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |