C23H24F3N3O2S — CID 169116855
(1Z)-1-amino-1-[5,5-dimethyl-1-(thiophene-2-carbonyl)-4-[[4-(trifluoromethyl)phenyl]methylimino]piperidin-3-ylidene]propan-2-one (PubChem CID 169116855) has the molecular formula C23H24F3N3O2S and a molecular weight of 463.53 g/mol. Its IUPAC name is (1Z)-1-amino-1-[5,5-dimethyl-1-(thiophene-2-carbonyl)-4-[[4-(trifluoromethyl)phenyl]methylimino]piperidin-3-ylidene]propan-2-one.
| Compound Name | (1Z)-1-amino-1-[5,5-dimethyl-1-(thiophene-2-carbonyl)-4-[[4-(trifluoromethyl)phenyl]methylimino]piperidin-3-ylidene]propan-2-one |
|---|---|
| PubChem CID | 169116855 |
| Molecular Formula | C23H24F3N3O2S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | (1Z)-1-amino-1-[5,5-dimethyl-1-(thiophene-2-carbonyl)-4-[[4-(trifluoromethyl)phenyl]methylimino]piperidin-3-ylidene]propan-2-one |
| SMILES | CC(=O)/C(N)=C1\CN(C(=O)c2cccs2)CC(C)(C)\C1=N/Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H24F3N3O2S/c1-14(30)19(27)17-12-29(21(31)18-5-4-10-32-18)13-22(2,3)20(17)28-11-15-6-8-16(9-7-15)23(24,25)26/h4-10H,11-13,27H2,1-3H3/b19-17-,28-20- |
| InChIKey | MVAPIHSEUSIEQF-HEVYIGSHSA-N |
| XLogP | 4.69 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|