C21H24ClN3O2Si — CID 169123893
2-(6-azaspiro[2.5]octan-6-yl)-5-chloro-6-methyl-N-[3-[methyl(oxo)silyl]phenyl]pyridine-3-carboxamide (PubChem CID 169123893) has the molecular formula C21H24ClN3O2Si and a molecular weight of 413.98 g/mol. Its IUPAC name is 2-(6-azaspiro[2.5]octan-6-yl)-5-chloro-6-methyl-N-[3-[methyl(oxo)silyl]phenyl]pyridine-3-carboxamide.
| Compound Name | 2-(6-azaspiro[2.5]octan-6-yl)-5-chloro-6-methyl-N-[3-[methyl(oxo)silyl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169123893 |
| Molecular Formula | C21H24ClN3O2Si |
| Molecular Weight | 413.98 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-(6-azaspiro[2.5]octan-6-yl)-5-chloro-6-methyl-N-[3-[methyl(oxo)silyl]phenyl]pyridine-3-carboxamide |
| SMILES | Cc1nc(N2CCC3(CC2)CC3)c(C(=O)Nc2cccc([Si](C)=O)c2)cc1Cl |
| InChI | InChI=1S/C21H24ClN3O2Si/c1-14-18(22)13-17(19(23-14)25-10-8-21(6-7-21)9-11-25)20(26)24-15-4-3-5-16(12-15)28(2)27/h3-5,12-13H,6-11H2,1-2H3,(H,24,26) |
| InChIKey | IXCKPKHMONSSNR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.98 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|