C21H27F2N3O3S — CID 169140613
(2'S,7R)-2-(2,2-difluoroethyl)-1'-[(2,4-dimethoxypyrimidin-5-yl)methyl]-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] (PubChem CID 169140613) has the molecular formula C21H27F2N3O3S and a molecular weight of 439.53 g/mol. Its IUPAC name is (2'S,7R)-2-(2,2-difluoroethyl)-1'-[(2,4-dimethoxypyrimidin-5-yl)methyl]-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine].
| Compound Name | (2'S,7R)-2-(2,2-difluoroethyl)-1'-[(2,4-dimethoxypyrimidin-5-yl)methyl]-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
|---|---|
| PubChem CID | 169140613 |
| Molecular Formula | C21H27F2N3O3S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2'S,7R)-2-(2,2-difluoroethyl)-1'-[(2,4-dimethoxypyrimidin-5-yl)methyl]-2'-methylspiro[4,5-dihydrothieno[2,3-c]pyran-7,4'-piperidine] |
| SMILES | COc1ncc(CN2CC[C@]3(C[C@@H]2C)OCCc2cc(CC(F)F)sc23)c(OC)n1 |
| InChI | InChI=1S/C21H27F2N3O3S/c1-13-10-21(18-14(4-7-29-21)8-16(30-18)9-17(22)23)5-6-26(13)12-15-11-24-20(28-3)25-19(15)27-2/h8,11,13,17H,4-7,9-10,12H2,1-3H3/t13-,21+/m0/s1 |
| InChIKey | VJFVGEVTRFVYII-YEJXKQKISA-N |
| XLogP | 3.82 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |