C19H28 — CID 169145814
ethane;7-ethynyl-3,3-di(propan-2-yl)-1,2-dihydroindene (PubChem CID 169145814) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is ethane;7-ethynyl-3,3-di(propan-2-yl)-1,2-dihydroindene.
| Compound Name | ethane;7-ethynyl-3,3-di(propan-2-yl)-1,2-dihydroindene |
|---|---|
| PubChem CID | 169145814 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | ethane;7-ethynyl-3,3-di(propan-2-yl)-1,2-dihydroindene |
| SMILES | C#Cc1cccc2c1CCC2(C(C)C)C(C)C.CC |
| InChI | InChI=1S/C17H22.C2H6/c1-6-14-8-7-9-16-15(14)10-11-17(16,12(2)3)13(4)5;1-2/h1,7-9,12-13H,10-11H2,2-5H3;1-2H3 |
| InChIKey | UFCSZNCZFIZORG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|