C10H8 — CID 23374754
2-ethynylbicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 23374754) has the molecular formula C10H8 and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-ethynylbicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 2-ethynylbicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 23374754 |
| Molecular Formula | C10H8 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-ethynylbicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C#Cc1cccc2c1CC2 |
| InChI | InChI=1S/C10H8/c1-2-8-4-3-5-9-6-7-10(8)9/h1,3-5H,6-7H2 |
| InChIKey | XFOGMLRNRWPDOY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|