C23H23F2N3O5S — CID 169147690
N-[[4-(difluoromethoxy)phenyl]methyl]-4-(2-methylsulfonylethyl)-12-oxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide (PubChem CID 169147690) has the molecular formula C23H23F2N3O5S and a molecular weight of 491.52 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-4-(2-methylsulfonylethyl)-12-oxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(2-methylsulfonylethyl)-12-oxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
|---|---|
| PubChem CID | 169147690 |
| Molecular Formula | C23H23F2N3O5S |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(2-methylsulfonylethyl)-12-oxo-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxamide |
| SMILES | CS(=O)(=O)CCN1CCn2c(=O)c(C(=O)NCc3ccc(OC(F)F)cc3)cc3cccc1c32 |
| InChI | InChI=1S/C23H23F2N3O5S/c1-34(31,32)12-11-27-9-10-28-20-16(3-2-4-19(20)27)13-18(22(28)30)21(29)26-14-15-5-7-17(8-6-15)33-23(24)25/h2-8,13,23H,9-12,14H2,1H3,(H,26,29) |
| InChIKey | PTWAEOXXDAAKOX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |